 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12N1C(CC2C(=O)Nc2ccccc2CC)CCC1 |
| InChI: | InChI=1/C23H25N3O2/c1-2-15-8-3-5-11-19(15)24-21(27)18-14-16-9-7-13-26(16)23(18)17-10-4-6-12-20(17)25-22(23)28/h3-6,8,10-12,16,18H,2,7,9,13-14H2,1H3,(H,24,27)(H,25,28)/t16-,18-,23-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=130.729 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 375.472 g/mol | logS: -4.93885 | SlogP: 3.83087 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.159128 | Sterimol/B1: 2.4462 | Sterimol/B2: 5.37701 | Sterimol/B3: 5.66597 | |||
| Sterimol/B4: 7.22772 | Sterimol/L: 14.4886 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 601.649 | Positive charged surface: 398.31 | Negative charged surface: 203.34 | Volume: 366.875 | |||
| Hydrophobic surface: 523.043 | Hydrophilic surface: 78.606 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
