 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N1CCCCC1)c1cc([nH]c1)C(=O)NC(Cc1ccccc1)CC |
| InChI: | InChI=1/C20H27N3O3S/c1-2-17(13-16-9-5-3-6-10-16)22-20(24)19-14-18(15-21-19)27(25,26)23-11-7-4-8-12-23/h3,5-6,9-10,14-15,17,21H,2,4,7-8,11-13H2,1H3,(H,22,24)/t17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=47.9794 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 389.52 g/mol | logS: -3.15321 | SlogP: 2.94037 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0917929 | Sterimol/B1: 2.47866 | Sterimol/B2: 3.35021 | Sterimol/B3: 5.23102 | |||
| Sterimol/B4: 9.84074 | Sterimol/L: 16.3386 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 659.674 | Positive charged surface: 417.592 | Negative charged surface: 242.082 | Volume: 373.25 | |||
| Hydrophobic surface: 522.778 | Hydrophilic surface: 136.896 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.