Type: Neutral
Formula: C18H20N2O5S2
SMILES: |
s1ccc(C)c1CCNC(=O)CCS(=O)(=O)c1cc2NC(=O)COc2cc1 |
InChI: |
InChI=1/C18H20N2O5S2/c1-12-5-8-26-16(12)4-7-19-17(21)6-9-27(23,24)13-2-3-15-14(10-13)20-18(22)11-25-15/h2-3,5,8,10H,4,6-7,9,11H2,1H3,(H,19,21)(H,20,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 408.499 g/mol | logS: -3.77788 | SlogP: 1.91009 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0433912 | Sterimol/B1: 3.15483 | Sterimol/B2: 3.41392 | Sterimol/B3: 5.07571 |
Sterimol/B4: 6.57746 | Sterimol/L: 20.8 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 668.034 | Positive charged surface: 378.037 | Negative charged surface: 289.998 | Volume: 353.5 |
Hydrophobic surface: 474.86 | Hydrophilic surface: 193.174 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |