Type: Neutral
Formula: C18H22N2O4S2
SMILES: |
s1cccc1S(=O)(=O)N1CC(CCC1)C(=O)Nc1ccc(OCC)cc1 |
InChI: |
InChI=1/C18H22N2O4S2/c1-2-24-16-9-7-15(8-10-16)19-18(21)14-5-3-11-20(13-14)26(22,23)17-6-4-12-25-17/h4,6-10,12,14H,2-3,5,11,13H2,1H3,(H,19,21)/t14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 394.516 g/mol | logS: -3.94633 | SlogP: 3.1862 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0365653 | Sterimol/B1: 3.09856 | Sterimol/B2: 4.35118 | Sterimol/B3: 4.37857 |
Sterimol/B4: 6.38988 | Sterimol/L: 20.4925 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 652.16 | Positive charged surface: 381.445 | Negative charged surface: 270.715 | Volume: 354.625 |
Hydrophobic surface: 531.461 | Hydrophilic surface: 120.699 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |