 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1ccccc1NC(=O)CC(=O)Nc1cc2c(N=C3N(CCCCC3)C2=O)cc1 |
| InChI: | InChI=1/C23H24N4O4/c1-31-19-8-5-4-7-18(19)26-22(29)14-21(28)24-15-10-11-17-16(13-15)23(30)27-12-6-2-3-9-20(27)25-17/h4-5,7-8,10-11,13H,2-3,6,9,12,14H2,1H3,(H,24,28)(H,26,29) |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=108.906 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 420.469 g/mol | logS: -4.85235 | SlogP: 3.7223 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0167284 | Sterimol/B1: 2.80088 | Sterimol/B2: 3.75472 | Sterimol/B3: 4.91595 | |||
| Sterimol/B4: 6.23055 | Sterimol/L: 21.274 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 708.361 | Positive charged surface: 496.041 | Negative charged surface: 212.32 | Volume: 389 | |||
| Hydrophobic surface: 577.153 | Hydrophilic surface: 131.208 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
