 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12N1C(CC2C(=O)N2CCN(CC2)c2ccccc2)CCC1 |
| InChI: | InChI=1/C25H28N4O2/c30-23(28-15-13-27(14-16-28)18-7-2-1-3-8-18)21-17-19-9-6-12-29(19)25(21)20-10-4-5-11-22(20)26-24(25)31/h1-5,7-8,10-11,19,21H,6,9,12-17H2,(H,26,31)/t19-,21-,25-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=203.479 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 416.525 g/mol | logS: -4.2039 | SlogP: 2.9786 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.117378 | Sterimol/B1: 3.08492 | Sterimol/B2: 4.04253 | Sterimol/B3: 5.30554 | |||
| Sterimol/B4: 7.11415 | Sterimol/L: 17.7245 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 641.729 | Positive charged surface: 444.174 | Negative charged surface: 197.555 | Volume: 399.875 | |||
| Hydrophobic surface: 565.679 | Hydrophilic surface: 76.05 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
