Type: Neutral
Formula: C18H19N3O5S
SMILES: |
S(=O)(=O)(CCC(=O)NCc1cccnc1)c1cc2OCC(=O)Nc2cc1C |
InChI: |
InChI=1/C18H19N3O5S/c1-12-7-14-15(26-11-18(23)21-14)8-16(12)27(24,25)6-4-17(22)20-10-13-3-2-5-19-9-13/h2-3,5,7-9H,4,6,10-11H2,1H3,(H,20,22)(H,21,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 389.432 g/mol | logS: -2.6516 | SlogP: 1.46752 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0391818 | Sterimol/B1: 2.41818 | Sterimol/B2: 3.45831 | Sterimol/B3: 4.17092 |
Sterimol/B4: 6.52751 | Sterimol/L: 21.2105 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 638.829 | Positive charged surface: 404.655 | Negative charged surface: 234.174 | Volume: 339 |
Hydrophobic surface: 430.489 | Hydrophilic surface: 208.34 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |