Type: Neutral
Formula: C21H25N5O3
SMILES: |
Oc1nncc2c1n(c1c2cccc1)C(CC)C(=O)NCCCN1CCCC1=O |
InChI: |
InChI=1/C21H25N5O3/c1-2-16(20(28)22-10-6-12-25-11-5-9-18(25)27)26-17-8-4-3-7-14(17)15-13-23-24-21(29)19(15)26/h3-4,7-8,13,16H,2,5-6,9-12H2,1H3,(H,22,28)(H,24,29)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 395.463 g/mol | logS: -3.30189 | SlogP: 2.4654 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.079761 | Sterimol/B1: 2.50842 | Sterimol/B2: 4.50232 | Sterimol/B3: 6.39547 |
Sterimol/B4: 6.61678 | Sterimol/L: 18.6799 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 668.385 | Positive charged surface: 437.175 | Negative charged surface: 220.405 | Volume: 375.375 |
Hydrophobic surface: 499.553 | Hydrophilic surface: 168.832 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |