 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1cc2c(n3c(c2)C(=O)N(N=C3C)CC(=O)NC2CCCc3c2cccc3)cc1 |
| InChI: | InChI=1/C23H21FN4O2/c1-14-26-27(23(30)21-12-16-11-17(24)9-10-20(16)28(14)21)13-22(29)25-19-8-4-6-15-5-2-3-7-18(15)19/h2-3,5,7,9-12,19H,4,6,8,13H2,1H3,(H,25,29)/t19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.681 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 404.445 g/mol | logS: -5.64836 | SlogP: 3.70697 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0482834 | Sterimol/B1: 3.05303 | Sterimol/B2: 3.26707 | Sterimol/B3: 4.4444 | |||
| Sterimol/B4: 6.96301 | Sterimol/L: 18.6459 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 651.709 | Positive charged surface: 375.218 | Negative charged surface: 271.014 | Volume: 370.75 | |||
| Hydrophobic surface: 556.942 | Hydrophilic surface: 94.767 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.