Type: Neutral
Formula: C21H20N4O2S
SMILES: |
s1c2c(n3c(c2)C(=O)N(N=C3)CC(=O)NC2CCCc3c2cccc3)cc1C |
InChI: |
InChI=1/C21H20N4O2S/c1-13-9-17-19(28-13)10-18-21(27)25(22-12-24(17)18)11-20(26)23-16-8-4-6-14-5-2-3-7-15(14)16/h2-3,5,7,9-10,12,16H,4,6,8,11H2,1H3,(H,23,26)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 392.483 g/mol | logS: -5.17824 | SlogP: 3.54769 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0483154 | Sterimol/B1: 2.54473 | Sterimol/B2: 4.63794 | Sterimol/B3: 5.36763 |
Sterimol/B4: 5.47304 | Sterimol/L: 19.0797 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 637.408 | Positive charged surface: 380.569 | Negative charged surface: 256.839 | Volume: 361.25 |
Hydrophobic surface: 523.413 | Hydrophilic surface: 113.995 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |