Type: Neutral
Formula: C16H15N3O3S
SMILES: |
S(CC=C)C=1NC(=O)C2=C(NC(=O)CC2c2cc(O)ccc2)N=1 |
InChI: |
InChI=1/C16H15N3O3S/c1-2-6-23-16-18-14-13(15(22)19-16)11(8-12(21)17-14)9-4-3-5-10(20)7-9/h2-5,7,11,20H,1,6,8H2,(H2,17,18,19,21,22)/t11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 329.38 g/mol | logS: -4.12033 | SlogP: 1.6123 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.163839 | Sterimol/B1: 2.98066 | Sterimol/B2: 4.68095 | Sterimol/B3: 4.90907 |
Sterimol/B4: 6.3327 | Sterimol/L: 16.2561 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 548.567 | Positive charged surface: 313.864 | Negative charged surface: 234.703 | Volume: 292.5 |
Hydrophobic surface: 260.918 | Hydrophilic surface: 287.649 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |