Type: Neutral
Formula: C18H22N4O
SMILES: |
O=C(Nc1cc(ccc1)CC)C1CCCN(C1)c1nccnc1 |
InChI: |
InChI=1/C18H22N4O/c1-2-14-5-3-7-16(11-14)21-18(23)15-6-4-10-22(13-15)17-12-19-8-9-20-17/h3,5,7-9,11-12,15H,2,4,6,10,13H2,1H3,(H,21,23)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.401 g/mol | logS: -2.4017 | SlogP: 2.89407 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0674143 | Sterimol/B1: 2.8173 | Sterimol/B2: 3.87296 | Sterimol/B3: 5.03163 |
Sterimol/B4: 7.0041 | Sterimol/L: 15.9821 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 582.524 | Positive charged surface: 441.103 | Negative charged surface: 141.421 | Volume: 313.25 |
Hydrophobic surface: 490.989 | Hydrophilic surface: 91.535 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |