 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC1CCc2c1cccc2)C1CCCN(C1)c1nccnc1 |
| InChI: | InChI=1/C19H22N4O/c24-19(22-17-8-7-14-4-1-2-6-16(14)17)15-5-3-11-23(13-15)18-12-20-9-10-21-18/h1-2,4,6,9-10,12,15,17H,3,5,7-8,11,13H2,(H,22,24)/t15-,17+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=110.445 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 322.412 g/mol | logS: -1.74224 | SlogP: 2.59217 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0586204 | Sterimol/B1: 2.15535 | Sterimol/B2: 4.64235 | Sterimol/B3: 4.64977 | |||
| Sterimol/B4: 5.6666 | Sterimol/L: 16.2692 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 584.831 | Positive charged surface: 436.233 | Negative charged surface: 148.598 | Volume: 321.5 | |||
| Hydrophobic surface: 525.54 | Hydrophilic surface: 59.291 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.