 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1c2c([nH]c1)cccc2)C(=O)NC1CCC(CC1)C)C1CCC(CC1)C |
| InChI: | InChI=1/C26H37N3O2/c1-17-7-11-19(12-8-17)25(30)29-24(26(31)28-21-13-9-18(2)10-14-21)15-20-16-27-23-6-4-3-5-22(20)23/h3-6,16-19,21,24,27H,7-15H2,1-2H3,(H,28,31)(H,29,30)/t17-,18-,19+,21+,24-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=88.3464 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 423.601 g/mol | logS: -6.41105 | SlogP: 4.71637 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.141817 | Sterimol/B1: 2.47632 | Sterimol/B2: 2.69893 | Sterimol/B3: 5.77193 | |||
| Sterimol/B4: 9.52511 | Sterimol/L: 15.9864 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 698.261 | Positive charged surface: 511.799 | Negative charged surface: 183.646 | Volume: 437.25 | |||
| Hydrophobic surface: 582.335 | Hydrophilic surface: 115.926 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.