Type: Neutral
Formula: C19H28N4O3S2
SMILES: |
s1nc2c(n1)cccc2S(=O)(=O)NC(C(C)C)C(=O)NC1CCCC(C)C1C |
InChI: |
InChI=1/C19H28N4O3S2/c1-11(2)17(19(24)20-14-8-5-7-12(3)13(14)4)23-28(25,26)16-10-6-9-15-18(16)22-27-21-15/h6,9-14,17,23H,5,7-8H2,1-4H3,(H,20,24)/t12-,13-,14+,17-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 424.59 g/mol | logS: -4.82406 | SlogP: 2.9351 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.106502 | Sterimol/B1: 2.83244 | Sterimol/B2: 4.26719 | Sterimol/B3: 4.58081 |
Sterimol/B4: 7.71326 | Sterimol/L: 16.6684 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 625.845 | Positive charged surface: 393.176 | Negative charged surface: 232.668 | Volume: 382.375 |
Hydrophobic surface: 392.557 | Hydrophilic surface: 233.288 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |