Type: Neutral
Formula: C17H16N4O3S2
SMILES: |
s1ccnc1NC(=O)C1N(S(=O)(=O)c2c3ncccc3ccc2)CCC1 |
InChI: |
InChI=1/C17H16N4O3S2/c22-16(20-17-19-9-11-25-17)13-6-3-10-21(13)26(23,24)14-7-1-4-12-5-2-8-18-15(12)14/h1-2,4-5,7-9,11,13H,3,6,10H2,(H,19,20,22)/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 388.472 g/mol | logS: -3.90716 | SlogP: 2.4831 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0772827 | Sterimol/B1: 2.48661 | Sterimol/B2: 3.09492 | Sterimol/B3: 5.04629 |
Sterimol/B4: 8.43204 | Sterimol/L: 17.0073 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 585.047 | Positive charged surface: 346.255 | Negative charged surface: 233.257 | Volume: 331 |
Hydrophobic surface: 477.083 | Hydrophilic surface: 107.964 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |