 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1c-2c(cc1C(=O)NC1CCCC(C)C1C)COc1c-2cccc1 |
| InChI: | InChI=1/C20H23NO2S/c1-12-6-5-8-16(13(12)2)21-20(22)18-10-14-11-23-17-9-4-3-7-15(17)19(14)24-18/h3-4,7,9-10,12-13,16H,5-6,8,11H2,1-2H3,(H,21,22)/t12-,13+,16+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=66.4561 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 341.475 g/mol | logS: -6.09377 | SlogP: 5.1284 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.045699 | Sterimol/B1: 3.15778 | Sterimol/B2: 3.4107 | Sterimol/B3: 3.96842 | |||
| Sterimol/B4: 6.49288 | Sterimol/L: 17.9645 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 597.358 | Positive charged surface: 372.064 | Negative charged surface: 225.293 | Volume: 333.25 | |||
| Hydrophobic surface: 501.623 | Hydrophilic surface: 95.735 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.