Type: Neutral
Formula: C21H22N2
SMILES: |
n1c2c(CCCC2)c(Nc2cc(ccc2)CC)c2c1cccc2 |
InChI: |
InChI=1/C21H22N2/c1-2-15-8-7-9-16(14-15)22-21-17-10-3-5-12-19(17)23-20-13-6-4-11-18(20)21/h3,5,7-10,12,14H,2,4,6,11,13H2,1H3,(H,22,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 302.421 g/mol | logS: -5.67169 | SlogP: 5.41951 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.105688 | Sterimol/B1: 2.97775 | Sterimol/B2: 4.99254 | Sterimol/B3: 5.62688 |
Sterimol/B4: 6.67174 | Sterimol/L: 14.793 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 568.072 | Positive charged surface: 379.625 | Negative charged surface: 185.213 | Volume: 319.5 |
Hydrophobic surface: 515.07 | Hydrophilic surface: 53.002 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |