Type: Neutral
Formula: C24H24N2OS
SMILES: |
S(CC(=O)N1CCCc2c1cccc2)c1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C24H24N2OS/c27-23(26-15-7-9-17-8-1-6-14-22(17)26)16-28-24-18-10-2-4-12-20(18)25-21-13-5-3-11-19(21)24/h1-2,4,6,8,10,12,14H,3,5,7,9,11,13,15-16H2 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 388.535 g/mol | logS: -6.35971 | SlogP: 5.18501 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.108812 | Sterimol/B1: 3.32366 | Sterimol/B2: 4.9738 | Sterimol/B3: 5.83716 |
Sterimol/B4: 7.21864 | Sterimol/L: 16.6824 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 653.569 | Positive charged surface: 419.229 | Negative charged surface: 229.687 | Volume: 375.875 |
Hydrophobic surface: 591.257 | Hydrophilic surface: 62.312 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |