Type: Neutral
Formula: C19H23N3O4S
SMILES: |
S(=O)(=O)(N1CC(CCC1)C(=O)Nc1ccccc1OCC)c1cccnc1 |
InChI: |
InChI=1/C19H23N3O4S/c1-2-26-18-10-4-3-9-17(18)21-19(23)15-7-6-12-22(14-15)27(24,25)16-8-5-11-20-13-16/h3-5,8-11,13,15H,2,6-7,12,14H2,1H3,(H,21,23)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 389.476 g/mol | logS: -2.72318 | SlogP: 2.5197 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.147865 | Sterimol/B1: 2.00826 | Sterimol/B2: 4.55965 | Sterimol/B3: 5.54259 |
Sterimol/B4: 8.58384 | Sterimol/L: 15.0819 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 635.997 | Positive charged surface: 422.463 | Negative charged surface: 213.534 | Volume: 356.75 |
Hydrophobic surface: 507.451 | Hydrophilic surface: 128.546 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |