 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc(Nc2nc3c(cccc3)c(c2)C(=O)NC2CCCCC2C)ccc1OC |
| InChI: | InChI=1/C25H29N3O3/c1-16-8-4-6-10-20(16)28-25(29)19-15-24(27-21-11-7-5-9-18(19)21)26-17-12-13-22(30-2)23(14-17)31-3/h5,7,9,11-16,20H,4,6,8,10H2,1-3H3,(H,26,27)(H,28,29)/t16-,20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=117.769 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 419.525 g/mol | logS: -5.8248 | SlogP: 5.3041 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0504729 | Sterimol/B1: 2.26603 | Sterimol/B2: 4.10265 | Sterimol/B3: 5.44265 | |||
| Sterimol/B4: 9.19244 | Sterimol/L: 20.1508 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 728.36 | Positive charged surface: 529.341 | Negative charged surface: 193.612 | Volume: 415.75 | |||
| Hydrophobic surface: 635.197 | Hydrophilic surface: 93.163 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.