Type: Neutral
Formula: C22H20N4
SMILES: |
[nH]1nc(cc1Nc1c2CCCCc2nc2c1cccc2)-c1ccccc1 |
InChI: |
InChI=1/C22H20N4/c1-2-8-15(9-3-1)20-14-21(26-25-20)24-22-16-10-4-6-12-18(16)23-19-13-7-5-11-17(19)22/h1-4,6,8-10,12,14H,5,7,11,13H2,(H2,23,24,25,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 340.43 g/mol | logS: -5.82503 | SlogP: 5.24724 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.213675 | Sterimol/B1: 2.89485 | Sterimol/B2: 4.66736 | Sterimol/B3: 6.69404 |
Sterimol/B4: 7.31437 | Sterimol/L: 15.1848 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 598.983 | Positive charged surface: 378.046 | Negative charged surface: 218.629 | Volume: 339 |
Hydrophobic surface: 506.47 | Hydrophilic surface: 92.513 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |