 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C=C(c2c1n(c1c2cccc1)C)C(=O)NC1CCCC(C)C1C)C1CCCCC1 |
| InChI: | InChI=1/C27H35N3O2/c1-17-10-9-14-22(18(17)2)28-26(31)21-16-30(19-11-5-4-6-12-19)27(32)25-24(21)20-13-7-8-15-23(20)29(25)3/h7-8,13,15-19,22H,4-6,9-12,14H2,1-3H3,(H,28,31)/t17-,18-,22+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=103.409 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 433.596 g/mol | logS: -5.99825 | SlogP: 5.6078 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.070238 | Sterimol/B1: 2.48104 | Sterimol/B2: 4.78131 | Sterimol/B3: 7.48001 | |||
| Sterimol/B4: 8.47094 | Sterimol/L: 16.5633 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 718.182 | Positive charged surface: 503.321 | Negative charged surface: 209.12 | Volume: 436.75 | |||
| Hydrophobic surface: 633.689 | Hydrophilic surface: 84.493 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.