 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1c2c(OCC1CNC(=O)C1c3c(cccc3)C(=O)N(C)C1c1c3c(n(c1)C)cccc3)c ccc2 |
| InChI: | InChI=1/C29H27N3O4/c1-31-16-22(19-9-5-6-12-23(19)31)27-26(20-10-3-4-11-21(20)29(34)32(27)2)28(33)30-15-18-17-35-24-13-7-8-14-25(24)36-18/h3-14,16,18,26-27H,15,17H2,1-2H3,(H,30,33)/t18-,26+,27-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=116.89 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 481.552 g/mol | logS: -5.65177 | SlogP: 4.4997 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.143762 | Sterimol/B1: 4.3096 | Sterimol/B2: 5.96783 | Sterimol/B3: 6.27944 | |||
| Sterimol/B4: 6.32624 | Sterimol/L: 18.9923 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 778.658 | Positive charged surface: 510.553 | Negative charged surface: 263.925 | Volume: 461.375 | |||
| Hydrophobic surface: 710.686 | Hydrophilic surface: 67.972 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.