 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc2c(cc1OC)C(=O)N(C)C(C2C(=O)NCCC[NH+]1CC[NH+](CC1)CC) c1cccnc1 |
| InChI: | InChI=1/C27H37N5O4/c1-5-31-12-14-32(15-13-31)11-7-10-29-26(33)24-20-16-22(35-3)23(36-4)17-21(20)27(34)30(2)25(24)19-8-6-9-28-18-19/h6,8-9,16-18,24-25H,5,7,10-15H2,1-4H3,(H,29,33)/p+2/t24-,25+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=148.748 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 497.64 g/mol | logS: -2.69136 | SlogP: -0.5856 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.150884 | Sterimol/B1: 3.35367 | Sterimol/B2: 5.17543 | Sterimol/B3: 7.36443 | |||
| Sterimol/B4: 7.39936 | Sterimol/L: 20.6053 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 847.731 | Positive charged surface: 710.252 | Negative charged surface: 137.479 | Volume: 500.875 | |||
| Hydrophobic surface: 688.176 | Hydrophilic surface: 159.555 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 2 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
