 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc2c(cc1OC)C(=O)N(C)C(C2C(=O)N1CC(CCC1)C(OCC)=O)c1cccn c1 |
| InChI: | InChI=1/C26H31N3O6/c1-5-35-26(32)17-9-7-11-29(15-17)25(31)22-18-12-20(33-3)21(34-4)13-19(18)24(30)28(2)23(22)16-8-6-10-27-14-16/h6,8,10,12-14,17,22-23H,5,7,9,11,15H2,1-4H3/t17-,22-,23-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=139.083 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 481.549 g/mol | logS: -3.20479 | SlogP: 2.9065 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.141767 | Sterimol/B1: 5.37966 | Sterimol/B2: 5.59447 | Sterimol/B3: 6.42556 | |||
| Sterimol/B4: 6.49214 | Sterimol/L: 20.0834 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 748.727 | Positive charged surface: 589.661 | Negative charged surface: 159.067 | Volume: 453.375 | |||
| Hydrophobic surface: 626.405 | Hydrophilic surface: 122.322 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.