 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CNC(=O)C1c2c(cc(OC)c(OC)c2)C(=O)N(C)C1c1cccnc1 |
| InChI: | InChI=1/C23H27N3O5/c1-26-21(14-6-4-8-24-12-14)20(22(27)25-13-15-7-5-9-31-15)16-10-18(29-2)19(30-3)11-17(16)23(26)28/h4,6,8,10-12,15,20-21H,5,7,9,13H2,1-3H3,(H,25,27)/t15-,20+,21+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=139.399 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 425.485 g/mol | logS: -2.96156 | SlogP: 2.4 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.167763 | Sterimol/B1: 2.23167 | Sterimol/B2: 2.33937 | Sterimol/B3: 8.06658 | |||
| Sterimol/B4: 10.0945 | Sterimol/L: 17.4225 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 690.409 | Positive charged surface: 559.171 | Negative charged surface: 131.238 | Volume: 400.75 | |||
| Hydrophobic surface: 599.021 | Hydrophilic surface: 91.388 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.