 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc2c(cc1OC)C(=O)N(C)C(C2C(=O)NCCC=1CCCCC=1)c1cccnc1 |
| InChI: | InChI=1/C26H31N3O4/c1-29-24(18-10-7-12-27-16-18)23(25(30)28-13-11-17-8-5-4-6-9-17)19-14-21(32-2)22(33-3)15-20(19)26(29)31/h7-8,10,12,14-16,23-24H,4-6,9,11,13H2,1-3H3,(H,28,30)/t23-,24-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=132.67 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 449.551 g/mol | logS: -4.23389 | SlogP: 4.1115 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.108918 | Sterimol/B1: 2.15318 | Sterimol/B2: 2.21959 | Sterimol/B3: 7.76823 | |||
| Sterimol/B4: 10.3544 | Sterimol/L: 18.7196 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 741.73 | Positive charged surface: 590.39 | Negative charged surface: 151.34 | Volume: 436.5 | |||
| Hydrophobic surface: 647.412 | Hydrophilic surface: 94.318 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.