Type: Neutral
Formula: C17H21N3O2S
SMILES: |
S1c2c(NC(=O)C1N1CCCCC1)cc(cc2)C(=O)NC1CC1 |
InChI: |
InChI=1/C17H21N3O2S/c21-15(18-12-5-6-12)11-4-7-14-13(10-11)19-16(22)17(23-14)20-8-2-1-3-9-20/h4,7,10,12,17H,1-3,5-6,8-9H2,(H,18,21)(H,19,22)/t17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 331.44 g/mol | logS: -3.98849 | SlogP: 2.435 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0877863 | Sterimol/B1: 3.00406 | Sterimol/B2: 4.85594 | Sterimol/B3: 5.01255 |
Sterimol/B4: 5.12438 | Sterimol/L: 15.7052 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 557.604 | Positive charged surface: 358.507 | Negative charged surface: 199.097 | Volume: 310.125 |
Hydrophobic surface: 373.656 | Hydrophilic surface: 183.948 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |