 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(Cc2ccc(cc2)CC)C(c2c1cccc2)C(=O)NC1CCCC(C)C1C |
| InChI: | InChI=1/C26H32N2O2/c1-4-19-12-14-20(15-13-19)16-28-24(21-9-5-6-10-22(21)26(28)30)25(29)27-23-11-7-8-17(2)18(23)3/h5-6,9-10,12-15,17-18,23-24H,4,7-8,11,16H2,1-3H3,(H,27,29)/t17-,18-,23-,24+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=102.024 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 404.554 g/mol | logS: -6.66516 | SlogP: 5.24887 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0889694 | Sterimol/B1: 2.60773 | Sterimol/B2: 3.69302 | Sterimol/B3: 4.4462 | |||
| Sterimol/B4: 10.3636 | Sterimol/L: 18.2493 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 708.152 | Positive charged surface: 456.944 | Negative charged surface: 251.208 | Volume: 419.75 | |||
| Hydrophobic surface: 595.493 | Hydrophilic surface: 112.659 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.