 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1ccc(cc1)-c1nc2c(cccc2)c(c1)C(=O)NC1CCCCC1C |
| InChI: | InChI=1/C24H26N2O2/c1-16-7-3-5-9-21(16)26-24(27)20-15-23(17-11-13-18(28-2)14-12-17)25-22-10-6-4-8-19(20)22/h4,6,8,10-16,21H,3,5,7,9H2,1-2H3,(H,26,27)/t16-,21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=98.968 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 374.484 g/mol | logS: -6.23802 | SlogP: 5.2189 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0541744 | Sterimol/B1: 2.19157 | Sterimol/B2: 4.38472 | Sterimol/B3: 5.65044 | |||
| Sterimol/B4: 10.1841 | Sterimol/L: 16.2276 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 665.908 | Positive charged surface: 433.932 | Negative charged surface: 221.72 | Volume: 378 | |||
| Hydrophobic surface: 594.252 | Hydrophilic surface: 71.656 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.