 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(CCCN(CC)c2cc(ccc2)C)C(c2c1cccc2)C(=O)NC1CCCCC1 |
| InChI: | InChI=1/C27H35N3O2/c1-3-29(22-14-9-11-20(2)19-22)17-10-18-30-25(23-15-7-8-16-24(23)27(30)32)26(31)28-21-12-5-4-6-13-21/h7-9,11,14-16,19,21,25H,3-6,10,12-13,17-18H2,1-2H3,(H,28,31)/t25-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=103.02 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 433.596 g/mol | logS: -5.91578 | SlogP: 4.95292 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.106681 | Sterimol/B1: 2.39586 | Sterimol/B2: 6.01786 | Sterimol/B3: 6.85694 | |||
| Sterimol/B4: 6.86012 | Sterimol/L: 18.294 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 778.528 | Positive charged surface: 523.338 | Negative charged surface: 255.189 | Volume: 451.5 | |||
| Hydrophobic surface: 685.061 | Hydrophilic surface: 93.467 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.