 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC)c1ccc(N2C(O)(c3c(NC2=O)cccc3)C(=O)NC2CCCCC2C)cc1 |
| InChI: | InChI=1/C24H29N3O4/c1-3-31-18-14-12-17(13-15-18)27-23(29)26-21-11-7-5-9-19(21)24(27,30)22(28)25-20-10-6-4-8-16(20)2/h5,7,9,11-16,20,30H,3-4,6,8,10H2,1-2H3,(H,25,28)(H,26,29)/t16-,20+,24+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=101.52 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 423.513 g/mol | logS: -5.34495 | SlogP: 4.2889 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.141211 | Sterimol/B1: 4.08109 | Sterimol/B2: 4.31429 | Sterimol/B3: 4.543 | |||
| Sterimol/B4: 6.45904 | Sterimol/L: 17.2812 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 648.552 | Positive charged surface: 429.909 | Negative charged surface: 218.643 | Volume: 405.375 | |||
| Hydrophobic surface: 503.839 | Hydrophilic surface: 144.713 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.