 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(cc1)C([NH+]1CCC(CC1)Cc1ccccc1)C(=O)NC1CCCCC1 |
| InChI: | InChI=1/C26H33ClN2O/c27-23-13-11-22(12-14-23)25(26(30)28-24-9-5-2-6-10-24)29-17-15-21(16-18-29)19-20-7-3-1-4-8-20/h1,3-4,7-8,11-14,21,24-25H,2,5-6,9-10,15-19H2,(H,28,30)/p+1/t25-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=70.5178 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 426.024 g/mol | logS: -6.38147 | SlogP: 4.46307 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0582515 | Sterimol/B1: 3.31457 | Sterimol/B2: 4.35318 | Sterimol/B3: 4.99637 | |||
| Sterimol/B4: 9.07949 | Sterimol/L: 19.9002 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 756.086 | Positive charged surface: 497.264 | Negative charged surface: 258.823 | Volume: 441.5 | |||
| Hydrophobic surface: 719.249 | Hydrophilic surface: 36.837 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
