 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(cc1)C(N1CCC(CC1)Cc1ccccc1)C(=O)NC1CCCCC1 |
| InChI: | InChI=1/C26H33ClN2O/c27-23-13-11-22(12-14-23)25(26(30)28-24-9-5-2-6-10-24)29-17-15-21(16-18-29)19-20-7-3-1-4-8-20/h1,3-4,7-8,11-14,21,24-25H,2,5-6,9-10,15-19H2,(H,28,30)/t25-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=99.1274 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 425.016 g/mol | logS: -6.40586 | SlogP: 5.88017 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0514065 | Sterimol/B1: 3.1489 | Sterimol/B2: 4.22122 | Sterimol/B3: 4.98582 | |||
| Sterimol/B4: 8.44799 | Sterimol/L: 19.6372 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 732.616 | Positive charged surface: 472.537 | Negative charged surface: 260.079 | Volume: 432.125 | |||
| Hydrophobic surface: 713.779 | Hydrophilic surface: 18.837 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
