 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1c2c(CCCC2)c(C([NH+]2CC[NH+](CC2)CCO)c2ncccc2)c1NC(=O)C |
| InChI: | InChI=1/C22H30N4O2S/c1-16(28)24-22-20(17-6-2-3-8-19(17)29-22)21(18-7-4-5-9-23-18)26-12-10-25(11-13-26)14-15-27/h4-5,7,9,21,27H,2-3,6,8,10-15H2,1H3,(H,24,28)/p+2/t21-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=108.424 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 416.59 g/mol | logS: -2.97769 | SlogP: -0.05916 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.306802 | Sterimol/B1: 2.75654 | Sterimol/B2: 2.94946 | Sterimol/B3: 8.01922 | |||
| Sterimol/B4: 9.9338 | Sterimol/L: 14.5711 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 670.926 | Positive charged surface: 513.593 | Negative charged surface: 157.333 | Volume: 413.25 | |||
| Hydrophobic surface: 561.105 | Hydrophilic surface: 109.821 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 2 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
