 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC1CCCCC1)C(N(Cc1ccccc1)c1ccccc1)c1ccc(cc1)C |
| InChI: | InChI=1/C28H32N2O/c1-22-17-19-24(20-18-22)27(28(31)29-25-13-7-3-8-14-25)30(26-15-9-4-10-16-26)21-23-11-5-2-6-12-23/h2,4-6,9-12,15-20,25,27H,3,7-8,13-14,21H2,1H3,(H,29,31)/t27-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=172.566 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 412.577 g/mol | logS: -6.96572 | SlogP: 6.55372 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.214124 | Sterimol/B1: 2.2958 | Sterimol/B2: 2.91865 | Sterimol/B3: 6.48507 | |||
| Sterimol/B4: 11.4435 | Sterimol/L: 14.8098 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 692.893 | Positive charged surface: 430.857 | Negative charged surface: 262.036 | Volume: 431.25 | |||
| Hydrophobic surface: 667.776 | Hydrophilic surface: 25.117 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.