 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CNC(=O)C1N(Cc2ccccc2OCC)C(=O)c2c1cccc2 |
| InChI: | InChI=1/C23H26N2O4/c1-2-28-20-12-6-3-8-16(20)15-25-21(18-10-4-5-11-19(18)23(25)27)22(26)24-14-17-9-7-13-29-17/h3-6,8,10-12,17,21H,2,7,9,13-15H2,1H3,(H,24,26)/t17-,21-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=107.569 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 394.471 g/mol | logS: -4.5605 | SlogP: 3.4395 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0766571 | Sterimol/B1: 2.52085 | Sterimol/B2: 5.21889 | Sterimol/B3: 5.34562 | |||
| Sterimol/B4: 7.29434 | Sterimol/L: 17.9825 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 674.683 | Positive charged surface: 469.815 | Negative charged surface: 204.869 | Volume: 384.875 | |||
| Hydrophobic surface: 597.1 | Hydrophilic surface: 77.583 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.