 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CNC(=O)C1c2c(cccc2)C(=O)N(C)C1c1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C24H25N3O3/c1-27-22(19-14-25-20-11-5-4-8-16(19)20)21(17-9-2-3-10-18(17)24(27)29)23(28)26-13-15-7-6-12-30-15/h2-5,8-11,14-15,21-22,25H,6-7,12-13H2,1H3,(H,26,28)/t15-,21-,22+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=88.3485 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 403.482 g/mol | logS: -4.40884 | SlogP: 3.4691 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.187891 | Sterimol/B1: 2.05882 | Sterimol/B2: 4.13362 | Sterimol/B3: 8.00783 | |||
| Sterimol/B4: 8.68918 | Sterimol/L: 16.9327 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 676.15 | Positive charged surface: 456.733 | Negative charged surface: 215.488 | Volume: 389.25 | |||
| Hydrophobic surface: 578.537 | Hydrophilic surface: 97.613 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.