Type: Neutral
Formula: C16H20N2O4
SMILES: |
O1CCCC1CNC(=O)C1ON=C(C1)c1cc(OC)ccc1 |
InChI: |
InChI=1/C16H20N2O4/c1-20-12-5-2-4-11(8-12)14-9-15(22-18-14)16(19)17-10-13-6-3-7-21-13/h2,4-5,8,13,15H,3,6-7,9-10H2,1H3,(H,17,19)/t13-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 304.346 g/mol | logS: -2.86607 | SlogP: 1.4834 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.025961 | Sterimol/B1: 3.35463 | Sterimol/B2: 3.64187 | Sterimol/B3: 4.3752 |
Sterimol/B4: 4.58177 | Sterimol/L: 19.7146 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 581.123 | Positive charged surface: 412.811 | Negative charged surface: 168.312 | Volume: 292.25 |
Hydrophobic surface: 466.161 | Hydrophilic surface: 114.962 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |