 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(CCOC)C(C(c2c1cccc2)C(=O)NCCC[NH+]1CCCC1)c1c2c([nH]c1)c ccc2 |
| InChI: | InChI=1/C28H34N4O3/c1-35-18-17-32-26(23-19-30-24-12-5-4-9-20(23)24)25(21-10-2-3-11-22(21)28(32)34)27(33)29-13-8-16-31-14-6-7-15-31/h2-5,9-12,19,25-26,30H,6-8,13-18H2,1H3,(H,29,33)/p+1/t25-,26-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=79.9368 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 475.613 g/mol | logS: -4.48411 | SlogP: 2.3755 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.122466 | Sterimol/B1: 2.89625 | Sterimol/B2: 3.82564 | Sterimol/B3: 6.23395 | |||
| Sterimol/B4: 9.96307 | Sterimol/L: 18.6448 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 773.187 | Positive charged surface: 580.3 | Negative charged surface: 192.6 | Volume: 481.25 | |||
| Hydrophobic surface: 655.237 | Hydrophilic surface: 117.95 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
