 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc(N2C(O)(c3c(NC2=O)cccc3)C(=O)NCCC=2CCCCC=2)ccc1 |
| InChI: | InChI=1/C24H27N3O4/c1-31-19-11-7-10-18(16-19)27-23(29)26-21-13-6-5-12-20(21)24(27,30)22(28)25-15-14-17-8-3-2-4-9-17/h5-8,10-13,16,30H,2-4,9,14-15H2,1H3,(H,25,28)(H,26,29)/t24-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=100.792 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 421.497 g/mol | logS: -5.31218 | SlogP: 4.2106 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.107099 | Sterimol/B1: 2.11983 | Sterimol/B2: 3.73205 | Sterimol/B3: 4.36255 | |||
| Sterimol/B4: 12.4425 | Sterimol/L: 14.8013 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 689.018 | Positive charged surface: 467.282 | Negative charged surface: 221.736 | Volume: 404.125 | |||
| Hydrophobic surface: 562.879 | Hydrophilic surface: 126.139 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.