 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1ccc(cc1)C1N(CCOC)C(=O)c2c(cccc2)C1C(=O)NCC1[NH+](CCC1)CC |
| InChI: | InChI=1/C26H32FN3O3/c1-3-29-14-6-7-20(29)17-28-25(31)23-21-8-4-5-9-22(21)26(32)30(15-16-33-2)24(23)18-10-12-19(27)13-11-18/h4-5,8-13,20,23-24H,3,6-7,14-17H2,1-2H3,(H,28,31)/p+1/t20-,23+,24-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=90.055 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 454.566 g/mol | logS: -4.61463 | SlogP: 2.0317 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.148617 | Sterimol/B1: 3.1298 | Sterimol/B2: 4.9787 | Sterimol/B3: 5.54702 | |||
| Sterimol/B4: 8.85522 | Sterimol/L: 17.6869 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 729.131 | Positive charged surface: 515.448 | Negative charged surface: 213.683 | Volume: 450.5 | |||
| Hydrophobic surface: 637.846 | Hydrophilic surface: 91.285 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
