 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(cc1)C(N(Cc1ccccc1)C)C(=O)NC1CCCCC1 |
| InChI: | InChI=1/C22H27ClN2O/c1-25(16-17-8-4-2-5-9-17)21(18-12-14-19(23)15-13-18)22(26)24-20-10-6-3-7-11-20/h2,4-5,8-9,12-15,20-21H,3,6-7,10-11,16H2,1H3,(H,24,26)/t21-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=89.5588 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 370.924 g/mol | logS: -5.40223 | SlogP: 5.3239 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.137995 | Sterimol/B1: 2.79527 | Sterimol/B2: 5.07803 | Sterimol/B3: 6.4885 | |||
| Sterimol/B4: 7.08347 | Sterimol/L: 15.8382 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 653.831 | Positive charged surface: 412.4 | Negative charged surface: 241.431 | Volume: 375.125 | |||
| Hydrophobic surface: 632.411 | Hydrophilic surface: 21.42 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
