Type: Neutral
Formula: C22H23N3O
SMILES: |
O=C(NC1CCCCC1)c1cc(nc2c1cccc2)Nc1ccccc1 |
InChI: |
InChI=1/C22H23N3O/c26-22(24-17-11-5-2-6-12-17)19-15-21(23-16-9-3-1-4-10-16)25-20-14-8-7-13-18(19)20/h1,3-4,7-10,13-15,17H,2,5-6,11-12H2,(H,23,25)(H,24,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 345.446 g/mol | logS: -5.52227 | SlogP: 5.0409 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0372856 | Sterimol/B1: 3.22023 | Sterimol/B2: 3.49601 | Sterimol/B3: 3.61504 |
Sterimol/B4: 8.72815 | Sterimol/L: 18.3003 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 625.276 | Positive charged surface: 403.624 | Negative charged surface: 216.648 | Volume: 348.75 |
Hydrophobic surface: 562.718 | Hydrophilic surface: 62.558 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |