 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC)c1ccc(cc1)-c1nc2c(cccc2)c(c1)C(=O)NC1CCCCC1C |
| InChI: | InChI=1/C25H28N2O2/c1-3-29-19-14-12-18(13-15-19)24-16-21(20-9-5-7-11-23(20)26-24)25(28)27-22-10-6-4-8-17(22)2/h5,7,9,11-17,22H,3-4,6,8,10H2,1-2H3,(H,27,28)/t17-,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=96.6964 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 388.511 g/mol | logS: -6.56523 | SlogP: 5.609 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0458239 | Sterimol/B1: 2.57209 | Sterimol/B2: 3.52709 | Sterimol/B3: 4.34058 | |||
| Sterimol/B4: 11.7564 | Sterimol/L: 17.4285 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 698.036 | Positive charged surface: 448.433 | Negative charged surface: 238.532 | Volume: 395.5 | |||
| Hydrophobic surface: 606.056 | Hydrophilic surface: 91.98 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.