Type: Neutral
Formula: C24H28N4OS
SMILES: |
S(CC(=O)NCc1ccc(cc1)C)c1nc(NC2CCCCC2)c2c(n1)cccc2 |
InChI: |
InChI=1/C24H28N4OS/c1-17-11-13-18(14-12-17)15-25-22(29)16-30-24-27-21-10-6-5-9-20(21)23(28-24)26-19-7-3-2-4-8-19/h5-6,9-14,19H,2-4,7-8,15-16H2,1H3,(H,25,29)(H,26,27,28) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 420.581 g/mol | logS: -7.75081 | SlogP: 5.35772 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.027284 | Sterimol/B1: 3.52533 | Sterimol/B2: 3.82647 | Sterimol/B3: 5.59946 |
Sterimol/B4: 6.78886 | Sterimol/L: 22.0102 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 764.377 | Positive charged surface: 494.883 | Negative charged surface: 264.413 | Volume: 414.5 |
Hydrophobic surface: 639.518 | Hydrophilic surface: 124.859 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |