Type: Neutral
Formula: C20H28N4OS
SMILES: |
S(CC(=O)NC(CC)C)c1nc(NC2CCCCC2)c2c(n1)cccc2 |
InChI: |
InChI=1/C20H28N4OS/c1-3-14(2)21-18(25)13-26-20-23-17-12-8-7-11-16(17)19(24-20)22-15-9-5-4-6-10-15/h7-8,11-12,14-15H,3-6,9-10,13H2,1-2H3,(H,21,25)(H,22,23,24)/t14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 372.537 g/mol | logS: -6.36518 | SlogP: 4.3812 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0482995 | Sterimol/B1: 1.97532 | Sterimol/B2: 5.01402 | Sterimol/B3: 5.61483 |
Sterimol/B4: 7.90418 | Sterimol/L: 18.1417 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 689.215 | Positive charged surface: 469.373 | Negative charged surface: 214.248 | Volume: 371.375 |
Hydrophobic surface: 537.421 | Hydrophilic surface: 151.794 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |