Type: Neutral
Formula: C24H23N3OS
SMILES: |
s1c2CCCCc2c2c1nc(nc2Nc1ccccc1OC)Cc1ccccc1 |
InChI: |
InChI=1/C24H23N3OS/c1-28-19-13-7-6-12-18(19)25-23-22-17-11-5-8-14-20(17)29-24(22)27-21(26-23)15-16-9-3-2-4-10-16/h2-4,6-7,9-10,12-13H,5,8,11,14-15H2,1H3,(H,25,26,27) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 401.534 g/mol | logS: -7.25819 | SlogP: 5.91301 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.080142 | Sterimol/B1: 2.53856 | Sterimol/B2: 3.82814 | Sterimol/B3: 4.07879 |
Sterimol/B4: 10.7517 | Sterimol/L: 15.1243 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 652.527 | Positive charged surface: 427.275 | Negative charged surface: 220.124 | Volume: 388.125 |
Hydrophobic surface: 617.005 | Hydrophilic surface: 35.522 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |