 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C)C(C(c2c1cccc2)C(=O)NCCC[NH+]1CCCC1)c1c2c([nH]c1)cccc 2 |
| InChI: | InChI=1/C26H30N4O2/c1-29-24(21-17-28-22-12-5-4-9-18(21)22)23(19-10-2-3-11-20(19)26(29)32)25(31)27-13-8-16-30-14-6-7-15-30/h2-5,9-12,17,23-24,28H,6-8,13-16H2,1H3,(H,27,31)/p+1/t23-,24+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=63.587 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 431.56 g/mol | logS: -4.34147 | SlogP: 2.3589 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.108195 | Sterimol/B1: 2.16419 | Sterimol/B2: 5.23241 | Sterimol/B3: 7.74813 | |||
| Sterimol/B4: 8.08423 | Sterimol/L: 18.875 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 752.312 | Positive charged surface: 529.317 | Negative charged surface: 219.21 | Volume: 435 | |||
| Hydrophobic surface: 632.276 | Hydrophilic surface: 120.036 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
